ChemNet > CAS > 6238-30-8 (+/-)3-Cyano-3-hydroxy 1-azabicyclo[2,2,2]octane
6238-30-8 (+/-)3-Cyano-3-hydroxy 1-azabicyclo[2,2,2]octane
| termék neve |
(+/-)3-Cyano-3-hydroxy 1-azabicyclo[2,2,2]octane |
| Angol név |
(+/-)3-Cyano-3-hydroxy 1-azabicyclo[2,2,2]octane; 3-Hydroxyquinuclidine-3-carbonitrile; 3-Quinuclidinol cyanohydrine; 3-hydroxy-1-azabicyclo[2.2.2]octane-3-carbonitrile; 3-{[3-(furan-2-ylmethyl)-4-oxo-2-thioxo-1,3-thiazolidin-5-ylidene]methyl}-2-[(2-hydroxyethyl)amino]-4H-pyrido[1,2-a]pyrimidin-4-one |
| MF |
C19H16N4O4S2 |
| Molekulatömeg |
428.4847 |
| InChI |
InChI=1/C19H16N4O4S2/c24-8-6-20-16-13(17(25)22-7-2-1-5-15(22)21-16)10-14-18(26)23(19(28)29-14)11-12-4-3-9-27-12/h1-5,7,9-10,20,24H,6,8,11H2 |
| CAS-szám |
6238-30-8 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.54g/cm3 |
| Olvadáspont |
161℃ |
| Forráspont |
534.7°C at 760 mmHg |
| Törésmutató |
1.752 |
| Gyulladáspont |
277.2°C |
| Gőznyomás |
2.89E-12mmHg at 25°C |
| Veszély szimbólumok |
Xn:Harmful;
|
| Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Biztonsági Leírás |
S36/37:Wear suitable protective clothing and gloves.;
|
|